C15H12N2OS — CID 15462565
4-(2,5-dimethylfuran-3-yl)-10-thia-3,6-diazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene (PubChem CID 15462565) has the molecular formula C15H12N2OS and a molecular weight of 268.34 g/mol. Its IUPAC name is 4-(2,5-dimethylfuran-3-yl)-10-thia-3,6-diazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene.
| Compound Name | 4-(2,5-dimethylfuran-3-yl)-10-thia-3,6-diazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene |
|---|---|
| PubChem CID | 15462565 |
| Molecular Formula | C15H12N2OS |
| Molecular Weight | 268.34 g/mol |
| Exact Mass | 268.07 |
| IUPAC Name | 4-(2,5-dimethylfuran-3-yl)-10-thia-3,6-diazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene |
| SMILES | Cc1cc(-c2cn3ccc4sccc4c3n2)c(C)o1 |
| InChI | InChI=1S/C15H12N2OS/c1-9-7-12(10(2)18-9)13-8-17-5-3-14-11(4-6-19-14)15(17)16-13/h3-8H,1-2H3 |
| InChIKey | QEQKDTHZUODFQX-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 30.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.34 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |