C17H14ClN5S — CID 143460922
3-N-chloro-3-N-methyl-1-N-(3-thiophen-2-ylimidazo[1,2-a]pyrazin-8-yl)benzene-1,3-diamine (PubChem CID 143460922) has the molecular formula C17H14ClN5S and a molecular weight of 355.85 g/mol. Its IUPAC name is 3-N-chloro-3-N-methyl-1-N-(3-thiophen-2-ylimidazo[1,2-a]pyrazin-8-yl)benzene-1,3-diamine.
| Compound Name | 3-N-chloro-3-N-methyl-1-N-(3-thiophen-2-ylimidazo[1,2-a]pyrazin-8-yl)benzene-1,3-diamine |
|---|---|
| PubChem CID | 143460922 |
| Molecular Formula | C17H14ClN5S |
| Molecular Weight | 355.85 g/mol |
| Exact Mass | 355.07 |
| IUPAC Name | 3-N-chloro-3-N-methyl-1-N-(3-thiophen-2-ylimidazo[1,2-a]pyrazin-8-yl)benzene-1,3-diamine |
| SMILES | CN(Cl)c1cccc(Nc2nccn3c(-c4cccs4)cnc23)c1 |
| InChI | InChI=1S/C17H14ClN5S/c1-22(18)13-5-2-4-12(10-13)21-16-17-20-11-14(15-6-3-9-24-15)23(17)8-7-19-16/h2-11H,1H3,(H,19,21) |
| InChIKey | KUCRBBRVGLDJBM-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 45.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.85 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|