C21H29N6P — CID 143757075
ethane;3-(3-methylimidazol-4-yl)-N-(3-methylphosphanylphenyl)imidazo[1,2-a]pyrazin-8-amine (PubChem CID 143757075) has the molecular formula C21H29N6P and a molecular weight of 396.48 g/mol. Its IUPAC name is ethane;3-(3-methylimidazol-4-yl)-N-(3-methylphosphanylphenyl)imidazo[1,2-a]pyrazin-8-amine.
| Compound Name | ethane;3-(3-methylimidazol-4-yl)-N-(3-methylphosphanylphenyl)imidazo[1,2-a]pyrazin-8-amine |
|---|---|
| PubChem CID | 143757075 |
| Molecular Formula | C21H29N6P |
| Molecular Weight | 396.48 g/mol |
| Exact Mass | 396.22 |
| IUPAC Name | ethane;3-(3-methylimidazol-4-yl)-N-(3-methylphosphanylphenyl)imidazo[1,2-a]pyrazin-8-amine |
| SMILES | CC.CC.CPc1cccc(Nc2nccn3c(-c4cncn4C)cnc23)c1 |
| InChI | InChI=1S/C17H17N6P.2C2H6/c1-22-11-18-9-14(22)15-10-20-17-16(19-6-7-23(15)17)21-12-4-3-5-13(8-12)24-2;2*1-2/h3-11,24H,1-2H3,(H,19,21);2*1-2H3 |
| InChIKey | GMXWLSVDHMMIOX-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 60.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.48 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|