C20H32O2 — CID 143461576
methanol;1-methoxy-3-(1-methylcyclohexyl)benzene;(3Z)-penta-1,3-diene (PubChem CID 143461576) has the molecular formula C20H32O2 and a molecular weight of 304.47 g/mol. Its IUPAC name is methanol;1-methoxy-3-(1-methylcyclohexyl)benzene;(3Z)-penta-1,3-diene.
| Compound Name | methanol;1-methoxy-3-(1-methylcyclohexyl)benzene;(3Z)-penta-1,3-diene |
|---|---|
| PubChem CID | 143461576 |
| Molecular Formula | C20H32O2 |
| Molecular Weight | 304.47 g/mol |
| Exact Mass | 304.24 |
| IUPAC Name | methanol;1-methoxy-3-(1-methylcyclohexyl)benzene;(3Z)-penta-1,3-diene |
| SMILES | C=C/C=C\C.CO.COc1cccc(C2(C)CCCCC2)c1 |
| InChI | InChI=1S/C14H20O.C5H8.CH4O/c1-14(9-4-3-5-10-14)12-7-6-8-13(11-12)15-2;1-3-5-4-2;1-2/h6-8,11H,3-5,9-10H2,1-2H3;3-5H,1H2,2H3;2H,1H3/b;5-4-; |
| InChIKey | ZSUASPWPGMTXMA-FXHNQCOHSA-N |
| XLogP | 5.27 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.47 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|