C21H33NO2 — CID 13363428
1-[4-(3-methoxyphenyl)-1-methylpiperidin-4-yl]cyclooctan-1-ol (PubChem CID 13363428) has the molecular formula C21H33NO2 and a molecular weight of 331.50 g/mol. Its IUPAC name is 1-[4-(3-methoxyphenyl)-1-methylpiperidin-4-yl]cyclooctan-1-ol.
| Compound Name | 1-[4-(3-methoxyphenyl)-1-methylpiperidin-4-yl]cyclooctan-1-ol |
|---|---|
| PubChem CID | 13363428 |
| Molecular Formula | C21H33NO2 |
| Molecular Weight | 331.50 g/mol |
| Exact Mass | 331.25 |
| IUPAC Name | 1-[4-(3-methoxyphenyl)-1-methylpiperidin-4-yl]cyclooctan-1-ol |
| SMILES | COc1cccc(C2(C3(O)CCCCCCC3)CCN(C)CC2)c1 |
| InChI | InChI=1S/C21H33NO2/c1-22-15-13-20(14-16-22,18-9-8-10-19(17-18)24-2)21(23)11-6-4-3-5-7-12-21/h8-10,17,23H,3-7,11-16H2,1-2H3 |
| InChIKey | KGCHKCLWANPJAA-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.50 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |