C16H23NO2 — CID 57075287
(4aR,8aR)-4a-(3-methoxyphenyl)-1,2,3,4,5,6,7,8-octahydroisoquinolin-8a-ol (PubChem CID 57075287) has the molecular formula C16H23NO2 and a molecular weight of 261.36 g/mol. Its IUPAC name is (4aR,8aR)-4a-(3-methoxyphenyl)-1,2,3,4,5,6,7,8-octahydroisoquinolin-8a-ol.
| Compound Name | (4aR,8aR)-4a-(3-methoxyphenyl)-1,2,3,4,5,6,7,8-octahydroisoquinolin-8a-ol |
|---|---|
| PubChem CID | 57075287 |
| Molecular Formula | C16H23NO2 |
| Molecular Weight | 261.36 g/mol |
| Exact Mass | 261.17 |
| IUPAC Name | (4aR,8aR)-4a-(3-methoxyphenyl)-1,2,3,4,5,6,7,8-octahydroisoquinolin-8a-ol |
| SMILES | COc1cccc([C@]23CCCC[C@]2(O)CNCC3)c1 |
| InChI | InChI=1S/C16H23NO2/c1-19-14-6-4-5-13(11-14)15-7-2-3-8-16(15,18)12-17-10-9-15/h4-6,11,17-18H,2-3,7-10,12H2,1H3/t15-,16+/m1/s1 |
| InChIKey | GTCLVWBKUVQHJX-CVEARBPZSA-N |
| XLogP | 2.23 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.36 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |