C23H24N2O2 — CID 154131456
(4aS,12aR)-4a-(3-methoxyphenyl)-1,2,3,4,5,12-hexahydropyrido[3,4-b]acridin-12a-ol (PubChem CID 154131456) has the molecular formula C23H24N2O2 and a molecular weight of 360.46 g/mol. Its IUPAC name is (4aS,12aR)-4a-(3-methoxyphenyl)-1,2,3,4,5,12-hexahydropyrido[3,4-b]acridin-12a-ol.
| Compound Name | (4aS,12aR)-4a-(3-methoxyphenyl)-1,2,3,4,5,12-hexahydropyrido[3,4-b]acridin-12a-ol |
|---|---|
| PubChem CID | 154131456 |
| Molecular Formula | C23H24N2O2 |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | (4aS,12aR)-4a-(3-methoxyphenyl)-1,2,3,4,5,12-hexahydropyrido[3,4-b]acridin-12a-ol |
| SMILES | COc1cccc([C@@]23CCNC[C@@]2(O)Cc2cc4ccccc4nc2C3)c1 |
| InChI | InChI=1S/C23H24N2O2/c1-27-19-7-4-6-18(12-19)22-9-10-24-15-23(22,26)13-17-11-16-5-2-3-8-20(16)25-21(17)14-22/h2-8,11-12,24,26H,9-10,13-15H2,1H3/t22-,23-/m0/s1 |
| InChIKey | YQEDKUMMGYJVBH-GOTSBHOMSA-N |
| XLogP | 3.00 |
| TPSA | 54.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |