C19H27NO3 — CID 57283982
1-[8a-hydroxy-4a-(3-methoxyphenyl)-1,2,3,4,5,6,7,8-octahydroisoquinolin-6-yl]propan-2-one (PubChem CID 57283982) has the molecular formula C19H27NO3 and a molecular weight of 317.43 g/mol. Its IUPAC name is 1-[8a-hydroxy-4a-(3-methoxyphenyl)-1,2,3,4,5,6,7,8-octahydroisoquinolin-6-yl]propan-2-one.
| Compound Name | 1-[8a-hydroxy-4a-(3-methoxyphenyl)-1,2,3,4,5,6,7,8-octahydroisoquinolin-6-yl]propan-2-one |
|---|---|
| PubChem CID | 57283982 |
| Molecular Formula | C19H27NO3 |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.20 |
| IUPAC Name | 1-[8a-hydroxy-4a-(3-methoxyphenyl)-1,2,3,4,5,6,7,8-octahydroisoquinolin-6-yl]propan-2-one |
| SMILES | COc1cccc(C23CCNCC2(O)CCC(CC(C)=O)C3)c1 |
| InChI | InChI=1S/C19H27NO3/c1-14(21)10-15-6-7-19(22)13-20-9-8-18(19,12-15)16-4-3-5-17(11-16)23-2/h3-5,11,15,20,22H,6-10,12-13H2,1-2H3 |
| InChIKey | RIVICYRLOXMYOU-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |