C26H31NO5 — CID 57232186
[(4aS,8aR)-8a-hydroxy-4a-(3-methoxyphenyl)-1-(2-phenylacetyl)-1,2,3,4,5,6,7,8-octahydroisoquinolin-6-yl] acetate (PubChem CID 57232186) has the molecular formula C26H31NO5 and a molecular weight of 437.54 g/mol. Its IUPAC name is [(4aS,8aR)-8a-hydroxy-4a-(3-methoxyphenyl)-1-(2-phenylacetyl)-1,2,3,4,5,6,7,8-octahydroisoquinolin-6-yl] acetate.
| Compound Name | [(4aS,8aR)-8a-hydroxy-4a-(3-methoxyphenyl)-1-(2-phenylacetyl)-1,2,3,4,5,6,7,8-octahydroisoquinolin-6-yl] acetate |
|---|---|
| PubChem CID | 57232186 |
| Molecular Formula | C26H31NO5 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.22 |
| IUPAC Name | [(4aS,8aR)-8a-hydroxy-4a-(3-methoxyphenyl)-1-(2-phenylacetyl)-1,2,3,4,5,6,7,8-octahydroisoquinolin-6-yl] acetate |
| SMILES | COc1cccc([C@@]23CCNC(C(=O)Cc4ccccc4)[C@@]2(O)CCC(OC(C)=O)C3)c1 |
| InChI | InChI=1S/C26H31NO5/c1-18(28)32-22-11-12-26(30)24(23(29)15-19-7-4-3-5-8-19)27-14-13-25(26,17-22)20-9-6-10-21(16-20)31-2/h3-10,16,22,24,27,30H,11-15,17H2,1-2H3/t22?,24?,25-,26-/m0/s1 |
| InChIKey | IFRXOFPBADYDNE-SDAFTYILSA-N |
| XLogP | 2.95 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |