C23H29ClO3 — CID 143461733
2-[4-[1-(4-chlorophenyl)cyclohexyl]phenoxy]propanoic acid;ethane (PubChem CID 143461733) has the molecular formula C23H29ClO3 and a molecular weight of 388.94 g/mol. Its IUPAC name is 2-[4-[1-(4-chlorophenyl)cyclohexyl]phenoxy]propanoic acid;ethane.
| Compound Name | 2-[4-[1-(4-chlorophenyl)cyclohexyl]phenoxy]propanoic acid;ethane |
|---|---|
| PubChem CID | 143461733 |
| Molecular Formula | C23H29ClO3 |
| Molecular Weight | 388.94 g/mol |
| Exact Mass | 388.18 |
| IUPAC Name | 2-[4-[1-(4-chlorophenyl)cyclohexyl]phenoxy]propanoic acid;ethane |
| SMILES | CC.CC(Oc1ccc(C2(c3ccc(Cl)cc3)CCCCC2)cc1)C(=O)O |
| InChI | InChI=1S/C21H23ClO3.C2H6/c1-15(20(23)24)25-19-11-7-17(8-12-19)21(13-3-2-4-14-21)16-5-9-18(22)10-6-16;1-2/h5-12,15H,2-4,13-14H2,1H3,(H,23,24);1-2H3 |
| InChIKey | PBUWEDZVZCYDLV-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.94 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |