C25H34O3 — CID 174340784
2-methyl-1-[4-[1-(4-propan-2-yloxyphenyl)cyclohexyl]phenoxy]propan-2-ol (PubChem CID 174340784) has the molecular formula C25H34O3 and a molecular weight of 382.54 g/mol. Its IUPAC name is 2-methyl-1-[4-[1-(4-propan-2-yloxyphenyl)cyclohexyl]phenoxy]propan-2-ol.
| Compound Name | 2-methyl-1-[4-[1-(4-propan-2-yloxyphenyl)cyclohexyl]phenoxy]propan-2-ol |
|---|---|
| PubChem CID | 174340784 |
| Molecular Formula | C25H34O3 |
| Molecular Weight | 382.54 g/mol |
| Exact Mass | 382.25 |
| IUPAC Name | 2-methyl-1-[4-[1-(4-propan-2-yloxyphenyl)cyclohexyl]phenoxy]propan-2-ol |
| SMILES | CC(C)Oc1ccc(C2(c3ccc(OCC(C)(C)O)cc3)CCCCC2)cc1 |
| InChI | InChI=1S/C25H34O3/c1-19(2)28-23-14-10-21(11-15-23)25(16-6-5-7-17-25)20-8-12-22(13-9-20)27-18-24(3,4)26/h8-15,19,26H,5-7,16-18H2,1-4H3 |
| InChIKey | ZMOXXYXNUCXKQE-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.54 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |