C24H28O2 — CID 167157883
4-[1-[4-(2-methylpent-3-ynoxy)phenyl]cyclohexyl]phenol (PubChem CID 167157883) has the molecular formula C24H28O2 and a molecular weight of 348.49 g/mol. Its IUPAC name is 4-[1-[4-(2-methylpent-3-ynoxy)phenyl]cyclohexyl]phenol.
| Compound Name | 4-[1-[4-(2-methylpent-3-ynoxy)phenyl]cyclohexyl]phenol |
|---|---|
| PubChem CID | 167157883 |
| Molecular Formula | C24H28O2 |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.21 |
| IUPAC Name | 4-[1-[4-(2-methylpent-3-ynoxy)phenyl]cyclohexyl]phenol |
| SMILES | CC#CC(C)COc1ccc(C2(c3ccc(O)cc3)CCCCC2)cc1 |
| InChI | InChI=1S/C24H28O2/c1-3-7-19(2)18-26-23-14-10-21(11-15-23)24(16-5-4-6-17-24)20-8-12-22(25)13-9-20/h8-15,19,25H,4-6,16-18H2,1-2H3 |
| InChIKey | YUQZWGZUUGYVDD-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|