C22H30O2 — CID 143461761
[1-[(3Z,5Z)-5,6-dimethoxy-2-methylidenehepta-3,5-dienyl]cyclohexyl]benzene (PubChem CID 143461761) has the molecular formula C22H30O2 and a molecular weight of 326.48 g/mol. Its IUPAC name is [1-[(3Z,5Z)-5,6-dimethoxy-2-methylidenehepta-3,5-dienyl]cyclohexyl]benzene.
| Compound Name | [1-[(3Z,5Z)-5,6-dimethoxy-2-methylidenehepta-3,5-dienyl]cyclohexyl]benzene |
|---|---|
| PubChem CID | 143461761 |
| Molecular Formula | C22H30O2 |
| Molecular Weight | 326.48 g/mol |
| Exact Mass | 326.22 |
| IUPAC Name | [1-[(3Z,5Z)-5,6-dimethoxy-2-methylidenehepta-3,5-dienyl]cyclohexyl]benzene |
| SMILES | C=C(/C=C\C(OC)=C(/C)OC)CC1(c2ccccc2)CCCCC1 |
| InChI | InChI=1S/C22H30O2/c1-18(13-14-21(24-4)19(2)23-3)17-22(15-9-6-10-16-22)20-11-7-5-8-12-20/h5,7-8,11-14H,1,6,9-10,15-17H2,2-4H3/b14-13-,21-19- |
| InChIKey | HGYAYPRRKRJQFV-PAIRNYBASA-N |
| XLogP | 5.92 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.48 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|