C21H27FO — CID 143461684
1-[1-[(2Z,3Z)-2-ethylidene-5-methoxyhexa-3,5-dienyl]cyclohexyl]-3-fluorobenzene (PubChem CID 143461684) has the molecular formula C21H27FO and a molecular weight of 314.44 g/mol. Its IUPAC name is 1-[1-[(2Z,3Z)-2-ethylidene-5-methoxyhexa-3,5-dienyl]cyclohexyl]-3-fluorobenzene.
| Compound Name | 1-[1-[(2Z,3Z)-2-ethylidene-5-methoxyhexa-3,5-dienyl]cyclohexyl]-3-fluorobenzene |
|---|---|
| PubChem CID | 143461684 |
| Molecular Formula | C21H27FO |
| Molecular Weight | 314.44 g/mol |
| Exact Mass | 314.20 |
| IUPAC Name | 1-[1-[(2Z,3Z)-2-ethylidene-5-methoxyhexa-3,5-dienyl]cyclohexyl]-3-fluorobenzene |
| SMILES | C=C(/C=C\C(=C/C)CC1(c2cccc(F)c2)CCCCC1)OC |
| InChI | InChI=1S/C21H27FO/c1-4-18(12-11-17(2)23-3)16-21(13-6-5-7-14-21)19-9-8-10-20(22)15-19/h4,8-12,15H,2,5-7,13-14,16H2,1,3H3/b12-11-,18-4+ |
| InChIKey | NYENSVVKPDUMGJ-CYOXGAJESA-N |
| XLogP | 6.08 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.44 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|