C12H14FNO — CID 121344932
2-[1-(3-fluorophenyl)cyclobutyl]acetamide (PubChem CID 121344932) has the molecular formula C12H14FNO and a molecular weight of 207.25 g/mol. Its IUPAC name is 2-[1-(3-fluorophenyl)cyclobutyl]acetamide.
| Compound Name | 2-[1-(3-fluorophenyl)cyclobutyl]acetamide |
|---|---|
| PubChem CID | 121344932 |
| Molecular Formula | C12H14FNO |
| Molecular Weight | 207.25 g/mol |
| Exact Mass | 207.11 |
| IUPAC Name | 2-[1-(3-fluorophenyl)cyclobutyl]acetamide |
| SMILES | NC(=O)CC1(c2cccc(F)c2)CCC1 |
| InChI | InChI=1S/C12H14FNO/c13-10-4-1-3-9(7-10)12(5-2-6-12)8-11(14)15/h1,3-4,7H,2,5-6,8H2,(H2,14,15) |
| InChIKey | XCQVQNNXMKLEBI-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.25 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |