About 3-iodo-2-methyl-3H-imidazo[1,5-b]isoquinoline
3-iodo-2-methyl-3H-imidazo[1,5-b]isoquinoline (PubChem CID 143462531) has the molecular formula C12H11IN2
and a molecular weight of 310.14 g/mol. Its IUPAC name is 3-iodo-2-methyl-3H-imidazo[1,5-b]isoquinoline.
Molecular Properties
| Compound Name | 3-iodo-2-methyl-3H-imidazo[1,5-b]isoquinoline |
| PubChem CID | 143462531 |
| Molecular Formula | C12H11IN2 |
| Molecular Weight | 310.14 g/mol |
| Exact Mass | 310.00 |
| IUPAC Name | 3-iodo-2-methyl-3H-imidazo[1,5-b]isoquinoline |
| SMILES | CN1C=C2C=c3ccccc3=CN2C1I |
| InChI | InChI=1S/C12H11IN2/c1-14-8-11-6-9-4-2-3-5-10(9)7-15(11)12(14)13/h2-8,12H,1H3 |
| InChIKey | UZESCIXAMKKKSJ-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.14 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 3-iodo-2-methyl-3H-imidazo[1,5-b]isoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-iodo-2-methyl-3H-imidazo[1,5-b]isoquinoline?
The IUPAC name of 3-iodo-2-methyl-3H-imidazo[1,5-b]isoquinoline (CID 143462531) is 3-iodo-2-methyl-3H-imidazo[1,5-b]isoquinoline.
What is the SMILES notation for 3-iodo-2-methyl-3H-imidazo[1,5-b]isoquinoline?
The canonical SMILES for 3-iodo-2-methyl-3H-imidazo[1,5-b]isoquinoline is CN1C=C2C=c3ccccc3=CN2C1I.
What is the InChIKey of 3-iodo-2-methyl-3H-imidazo[1,5-b]isoquinoline?
The InChIKey is UZESCIXAMKKKSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11IN2/c1-14-8-11-6-9-4-2-3-5-10(9)7-15(11)12(14)13/h2-8,12H,1H3.
What are the key properties of 3-iodo-2-methyl-3H-imidazo[1,5-b]isoquinoline?
3-iodo-2-methyl-3H-imidazo[1,5-b]isoquinoline has a molecular weight of 310.14 g/mol, XLogP of 1.03, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-iodo-2-methyl-3H-imidazo[1,5-b]isoquinoline is sourced from PubChem (CID 143462531), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).