About CID 177491697
CID 177491697 (PubChem CID 177491697) has the molecular formula C20H28ClN2PSi+
and a molecular weight of 390.97 g/mol.
Molecular Properties
| Compound Name | CID 177491697 |
| PubChem CID | 177491697 |
| Molecular Formula | C20H28ClN2PSi+ |
| Molecular Weight | 390.97 g/mol |
| Exact Mass | 390.14 |
| IUPAC Name | — |
| SMILES | CC(C)(C)N1[Si](Cl)N(C(C)(C)C)[P+]1(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H28ClN2PSi/c1-19(2,3)22-24(17-13-9-7-10-14-17,18-15-11-8-12-16-18)23(25(22)21)20(4,5)6/h7-16H,1-6H3/q+1 |
| InChIKey | CAFGFHTWFSBHMN-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 390.97 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|
Analyze CID 177491697 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 177491697?
The IUPAC name of CID 177491697 (CID 177491697) is not available.
What is the SMILES notation for CID 177491697?
The canonical SMILES for CID 177491697 is CC(C)(C)N1[Si](Cl)N(C(C)(C)C)[P+]1(c1ccccc1)c1ccccc1.
What is the InChIKey of CID 177491697?
The InChIKey is CAFGFHTWFSBHMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H28ClN2PSi/c1-19(2,3)22-24(17-13-9-7-10-14-17,18-15-11-8-12-16-18)23(25(22)21)20(4,5)6/h7-16H,1-6H3/q+1.
What are the key properties of CID 177491697?
CID 177491697 has a molecular weight of 390.97 g/mol, XLogP of 4.92, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 177491697 is sourced from PubChem (CID 177491697), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).