C24H37P4+ — CID 102109459
2,3,4-tritert-butyl-1,1-diphenyltetraphosphetan-1-ium (PubChem CID 102109459) has the molecular formula C24H37P4+ and a molecular weight of 449.46 g/mol. Its IUPAC name is 2,3,4-tritert-butyl-1,1-diphenyltetraphosphetan-1-ium.
| Compound Name | 2,3,4-tritert-butyl-1,1-diphenyltetraphosphetan-1-ium |
|---|---|
| PubChem CID | 102109459 |
| Molecular Formula | C24H37P4+ |
| Molecular Weight | 449.46 g/mol |
| Exact Mass | 449.18 |
| IUPAC Name | 2,3,4-tritert-butyl-1,1-diphenyltetraphosphetan-1-ium |
| SMILES | CC(C)(C)P1P(C(C)(C)C)[P+](c2ccccc2)(c2ccccc2)P1C(C)(C)C |
| InChI | InChI=1S/C24H37P4/c1-22(2,3)25-26(23(4,5)6)28(27(25)24(7,8)9,20-16-12-10-13-17-20)21-18-14-11-15-19-21/h10-19H,1-9H3/q+1 |
| InChIKey | BMUFHYONMWBYFB-UHFFFAOYSA-N |
| XLogP | 9.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.46 |
| LogP ≤ 5 | 9.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|