C16H23AsO2 — CID 12633123
1-[2,2-dimethylpropanoyl(phenyl)arsanyl]-2,2-dimethylpropan-1-one (PubChem CID 12633123) has the molecular formula C16H23AsO2 and a molecular weight of 322.28 g/mol. Its IUPAC name is 1-[2,2-dimethylpropanoyl(phenyl)arsanyl]-2,2-dimethylpropan-1-one.
| Compound Name | 1-[2,2-dimethylpropanoyl(phenyl)arsanyl]-2,2-dimethylpropan-1-one |
|---|---|
| PubChem CID | 12633123 |
| Molecular Formula | C16H23AsO2 |
| Molecular Weight | 322.28 g/mol |
| Exact Mass | 322.09 |
| IUPAC Name | 1-[2,2-dimethylpropanoyl(phenyl)arsanyl]-2,2-dimethylpropan-1-one |
| SMILES | CC(C)(C)C(=O)[As](C(=O)C(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C16H23AsO2/c1-15(2,3)13(18)17(14(19)16(4,5)6)12-10-8-7-9-11-12/h7-11H,1-6H3 |
| InChIKey | XCFRQNNNMBNCAI-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.28 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|