C18H34N4O4 — CID 143462721
ethane;ethyl (Z)-3-[[(E)-3-(carbamoylamino)-3-methylbut-1-enyl]amino]-2-methanimidoyl-3-(2-methylpropoxy)prop-2-enoate (PubChem CID 143462721) has the molecular formula C18H34N4O4 and a molecular weight of 370.49 g/mol. Its IUPAC name is ethane;ethyl (Z)-3-[[(E)-3-(carbamoylamino)-3-methylbut-1-enyl]amino]-2-methanimidoyl-3-(2-methylpropoxy)prop-2-enoate.
| Compound Name | ethane;ethyl (Z)-3-[[(E)-3-(carbamoylamino)-3-methylbut-1-enyl]amino]-2-methanimidoyl-3-(2-methylpropoxy)prop-2-enoate |
|---|---|
| PubChem CID | 143462721 |
| Molecular Formula | C18H34N4O4 |
| Molecular Weight | 370.49 g/mol |
| Exact Mass | 370.26 |
| IUPAC Name | ethane;ethyl (Z)-3-[[(E)-3-(carbamoylamino)-3-methylbut-1-enyl]amino]-2-methanimidoyl-3-(2-methylpropoxy)prop-2-enoate |
| SMILES | CC.[H]/N=C/C(C(=O)OCC)=C(\N/C=C/C(C)(C)NC(N)=O)OCC(C)C |
| InChI | InChI=1S/C16H28N4O4.C2H6/c1-6-23-14(21)12(9-17)13(24-10-11(2)3)19-8-7-16(4,5)20-15(18)22;1-2/h7-9,11,17,19H,6,10H2,1-5H3,(H3,18,20,22);1-2H3/b8-7+,13-12-,17-9+; |
| InChIKey | CKEWSXKLWWKEMK-KMONODQZSA-N |
| XLogP | 2.66 |
| TPSA | 126.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.49 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|