C33H51FN4O3 — CID 143464132
N,N-diethyl-2-methoxyethanamine;ethane;(E)-5-[3-fluoro-5-[2-(3-methylanilino)-5H-1,3-diazepin-4-yl]cyclohepta-1,3-dien-1-yl]oxypent-2-en-1-ol (PubChem CID 143464132) has the molecular formula C33H51FN4O3 and a molecular weight of 570.79 g/mol. Its IUPAC name is N,N-diethyl-2-methoxyethanamine;ethane;(E)-5-[3-fluoro-5-[2-(3-methylanilino)-5H-1,3-diazepin-4-yl]cyclohepta-1,3-dien-1-yl]oxypent-2-en-1-ol.
| Compound Name | N,N-diethyl-2-methoxyethanamine;ethane;(E)-5-[3-fluoro-5-[2-(3-methylanilino)-5H-1,3-diazepin-4-yl]cyclohepta-1,3-dien-1-yl]oxypent-2-en-1-ol |
|---|---|
| PubChem CID | 143464132 |
| Molecular Formula | C33H51FN4O3 |
| Molecular Weight | 570.79 g/mol |
| Exact Mass | 570.39 |
| IUPAC Name | N,N-diethyl-2-methoxyethanamine;ethane;(E)-5-[3-fluoro-5-[2-(3-methylanilino)-5H-1,3-diazepin-4-yl]cyclohepta-1,3-dien-1-yl]oxypent-2-en-1-ol |
| SMILES | CC.CCN(CC)CCOC.Cc1cccc(NC2=NC=CCC(C3C=C(F)C=C(OCC/C=C/CO)CC3)=N2)c1 |
| InChI | InChI=1S/C24H28FN3O2.C7H17NO.C2H6/c1-18-7-5-8-21(15-18)27-24-26-12-6-9-23(28-24)19-10-11-22(17-20(25)16-19)30-14-4-2-3-13-29;1-4-8(5-2)6-7-9-3;1-2/h2-3,5-8,12,15-17,19,29H,4,9-11,13-14H2,1H3,(H,26,27);4-7H2,1-3H3;1-2H3/b3-2+;; |
| InChIKey | OIPBLPFMRIJGHX-WTVBWJGASA-N |
| XLogP | 7.22 |
| TPSA | 78.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.79 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|