C22H23N5O — CID 143465123
3-(8-aminoimidazo[1,2-a]pyrazin-5-yl)-N-benzylbenzamide;ethane (PubChem CID 143465123) has the molecular formula C22H23N5O and a molecular weight of 373.46 g/mol. Its IUPAC name is 3-(8-aminoimidazo[1,2-a]pyrazin-5-yl)-N-benzylbenzamide;ethane.
| Compound Name | 3-(8-aminoimidazo[1,2-a]pyrazin-5-yl)-N-benzylbenzamide;ethane |
|---|---|
| PubChem CID | 143465123 |
| Molecular Formula | C22H23N5O |
| Molecular Weight | 373.46 g/mol |
| Exact Mass | 373.19 |
| IUPAC Name | 3-(8-aminoimidazo[1,2-a]pyrazin-5-yl)-N-benzylbenzamide;ethane |
| SMILES | CC.Nc1ncc(-c2cccc(C(=O)NCc3ccccc3)c2)n2ccnc12 |
| InChI | InChI=1S/C20H17N5O.C2H6/c21-18-19-22-9-10-25(19)17(13-23-18)15-7-4-8-16(11-15)20(26)24-12-14-5-2-1-3-6-14;1-2/h1-11,13H,12H2,(H2,21,23)(H,24,26);1-2H3 |
| InChIKey | RAFNFQSNLGAROL-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 85.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.46 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |