C20H20N8O — CID 87530745
3-[5-amino-6-[(E)-(diaminomethylidenehydrazinylidene)methyl]pyrazin-2-yl]-N-benzylbenzamide (PubChem CID 87530745) has the molecular formula C20H20N8O and a molecular weight of 388.44 g/mol. Its IUPAC name is 3-[5-amino-6-[(E)-(diaminomethylidenehydrazinylidene)methyl]pyrazin-2-yl]-N-benzylbenzamide.
| Compound Name | 3-[5-amino-6-[(E)-(diaminomethylidenehydrazinylidene)methyl]pyrazin-2-yl]-N-benzylbenzamide |
|---|---|
| PubChem CID | 87530745 |
| Molecular Formula | C20H20N8O |
| Molecular Weight | 388.44 g/mol |
| Exact Mass | 388.18 |
| IUPAC Name | 3-[5-amino-6-[(E)-(diaminomethylidenehydrazinylidene)methyl]pyrazin-2-yl]-N-benzylbenzamide |
| SMILES | NC(N)=N/N=C/c1nc(-c2cccc(C(=O)NCc3ccccc3)c2)cnc1N |
| InChI | InChI=1S/C20H20N8O/c21-18-17(12-26-28-20(22)23)27-16(11-24-18)14-7-4-8-15(9-14)19(29)25-10-13-5-2-1-3-6-13/h1-9,11-12H,10H2,(H2,21,24)(H,25,29)(H4,22,23,28)/b26-12+ |
| InChIKey | OCBOGBIPBOOVFA-RPPGKUMJSA-N |
| XLogP | 1.26 |
| TPSA | 157.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.44 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|