C16H17N7 — CID 143465308
N'-ethenyl-1-methyl-5-(1-methylpyrazol-4-yl)-N-pyridin-3-ylimidazole-2-carboximidamide (PubChem CID 143465308) has the molecular formula C16H17N7 and a molecular weight of 307.36 g/mol. Its IUPAC name is N'-ethenyl-1-methyl-5-(1-methylpyrazol-4-yl)-N-pyridin-3-ylimidazole-2-carboximidamide.
| Compound Name | N'-ethenyl-1-methyl-5-(1-methylpyrazol-4-yl)-N-pyridin-3-ylimidazole-2-carboximidamide |
|---|---|
| PubChem CID | 143465308 |
| Molecular Formula | C16H17N7 |
| Molecular Weight | 307.36 g/mol |
| Exact Mass | 307.15 |
| IUPAC Name | N'-ethenyl-1-methyl-5-(1-methylpyrazol-4-yl)-N-pyridin-3-ylimidazole-2-carboximidamide |
| SMILES | C=C/N=C(/Nc1cccnc1)c1ncc(-c2cnn(C)c2)n1C |
| InChI | InChI=1S/C16H17N7/c1-4-18-15(21-13-6-5-7-17-9-13)16-19-10-14(23(16)3)12-8-20-22(2)11-12/h4-11H,1H2,2-3H3,(H,18,21) |
| InChIKey | ADLBDAZESBHJCE-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 72.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.36 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|