C16H26FNO — CID 143466122
1-[4-[(3E,5Z)-3-fluoro-2-methylhepta-1,3,5-trienyl]piperidin-1-yl]propan-2-ol (PubChem CID 143466122) has the molecular formula C16H26FNO and a molecular weight of 267.39 g/mol. Its IUPAC name is 1-[4-[(3E,5Z)-3-fluoro-2-methylhepta-1,3,5-trienyl]piperidin-1-yl]propan-2-ol.
| Compound Name | 1-[4-[(3E,5Z)-3-fluoro-2-methylhepta-1,3,5-trienyl]piperidin-1-yl]propan-2-ol |
|---|---|
| PubChem CID | 143466122 |
| Molecular Formula | C16H26FNO |
| Molecular Weight | 267.39 g/mol |
| Exact Mass | 267.20 |
| IUPAC Name | 1-[4-[(3E,5Z)-3-fluoro-2-methylhepta-1,3,5-trienyl]piperidin-1-yl]propan-2-ol |
| SMILES | C/C=C\C=C(\F)C(C)=CC1CCN(CC(C)O)CC1 |
| InChI | InChI=1S/C16H26FNO/c1-4-5-6-16(17)13(2)11-15-7-9-18(10-8-15)12-14(3)19/h4-6,11,14-15,19H,7-10,12H2,1-3H3/b5-4-,13-11?,16-6+ |
| InChIKey | YICMTBGQYFVPDF-NFFSYWSFSA-N |
| XLogP | 3.45 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.39 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|