C21H25N3O — CID 143467381
(2E,8aS)-2-[[3-ethyl-4-(4-methylimidazol-1-yl)phenyl]methylidene]-1,5,6,7,8,8a-hexahydroindolizin-3-one (PubChem CID 143467381) has the molecular formula C21H25N3O and a molecular weight of 335.45 g/mol. Its IUPAC name is (2E,8aS)-2-[[3-ethyl-4-(4-methylimidazol-1-yl)phenyl]methylidene]-1,5,6,7,8,8a-hexahydroindolizin-3-one.
| Compound Name | (2E,8aS)-2-[[3-ethyl-4-(4-methylimidazol-1-yl)phenyl]methylidene]-1,5,6,7,8,8a-hexahydroindolizin-3-one |
|---|---|
| PubChem CID | 143467381 |
| Molecular Formula | C21H25N3O |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.20 |
| IUPAC Name | (2E,8aS)-2-[[3-ethyl-4-(4-methylimidazol-1-yl)phenyl]methylidene]-1,5,6,7,8,8a-hexahydroindolizin-3-one |
| SMILES | CCc1cc(/C=C2\C[C@@H]3CCCCN3C2=O)ccc1-n1cnc(C)c1 |
| InChI | InChI=1S/C21H25N3O/c1-3-17-10-16(7-8-20(17)23-13-15(2)22-14-23)11-18-12-19-6-4-5-9-24(19)21(18)25/h7-8,10-11,13-14,19H,3-6,9,12H2,1-2H3/b18-11+/t19-/m0/s1 |
| InChIKey | LDWCBUKCZRGMIY-MVDPLZLPSA-N |
| XLogP | 3.91 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|