About 10-oxo-N,N-bis(prop-2-enyl)decanamide
10-oxo-N,N-bis(prop-2-enyl)decanamide (PubChem CID 143467554) has the molecular formula C16H27NO2
and a molecular weight of 265.40 g/mol. Its IUPAC name is 10-oxo-N,N-bis(prop-2-enyl)decanamide.
Molecular Properties
| Compound Name | 10-oxo-N,N-bis(prop-2-enyl)decanamide |
| PubChem CID | 143467554 |
| Molecular Formula | C16H27NO2 |
| Molecular Weight | 265.40 g/mol |
| Exact Mass | 265.20 |
| IUPAC Name | 10-oxo-N,N-bis(prop-2-enyl)decanamide |
| SMILES | C=CCN(CC=C)C(=O)CCCCCCCCC=O |
| InChI | InChI=1S/C16H27NO2/c1-3-13-17(14-4-2)16(19)12-10-8-6-5-7-9-11-15-18/h3-4,15H,1-2,5-14H2 |
| InChIKey | GXVJQLUPQWFLPT-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.40 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 10-oxo-N,N-bis(prop-2-enyl)decanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-oxo-N,N-bis(prop-2-enyl)decanamide?
The IUPAC name of 10-oxo-N,N-bis(prop-2-enyl)decanamide (CID 143467554) is 10-oxo-N,N-bis(prop-2-enyl)decanamide.
What is the SMILES notation for 10-oxo-N,N-bis(prop-2-enyl)decanamide?
The canonical SMILES for 10-oxo-N,N-bis(prop-2-enyl)decanamide is C=CCN(CC=C)C(=O)CCCCCCCCC=O.
What is the InChIKey of 10-oxo-N,N-bis(prop-2-enyl)decanamide?
The InChIKey is GXVJQLUPQWFLPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H27NO2/c1-3-13-17(14-4-2)16(19)12-10-8-6-5-7-9-11-15-18/h3-4,15H,1-2,5-14H2.
What are the key properties of 10-oxo-N,N-bis(prop-2-enyl)decanamide?
10-oxo-N,N-bis(prop-2-enyl)decanamide has a molecular weight of 265.40 g/mol, XLogP of 3.51, 13 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 10-oxo-N,N-bis(prop-2-enyl)decanamide is sourced from PubChem (CID 143467554), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).