C12H17I2N5O2 — CID 143469548
7-[4-[hydroxy(methoxy)-λ3-iodanyl]cyclohexyl]-5-iodoimidazo[5,1-f][1,2,4]triazin-4-amine (PubChem CID 143469548) has the molecular formula C12H17I2N5O2 and a molecular weight of 517.11 g/mol. Its IUPAC name is 7-[4-[hydroxy(methoxy)-λ3-iodanyl]cyclohexyl]-5-iodoimidazo[5,1-f][1,2,4]triazin-4-amine.
| Compound Name | 7-[4-[hydroxy(methoxy)-λ3-iodanyl]cyclohexyl]-5-iodoimidazo[5,1-f][1,2,4]triazin-4-amine |
|---|---|
| PubChem CID | 143469548 |
| Molecular Formula | C12H17I2N5O2 |
| Molecular Weight | 517.11 g/mol |
| Exact Mass | 516.95 |
| IUPAC Name | 7-[4-[hydroxy(methoxy)-λ3-iodanyl]cyclohexyl]-5-iodoimidazo[5,1-f][1,2,4]triazin-4-amine |
| SMILES | COI(O)C1CCC(c2nc(I)c3c(N)ncnn23)CC1 |
| InChI | InChI=1S/C12H17I2N5O2/c1-21-14(20)8-4-2-7(3-5-8)12-18-10(13)9-11(15)16-6-17-19(9)12/h6-8,20H,2-5H2,1H3,(H2,15,16,17) |
| InChIKey | RHZUXBYPMQFXMH-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 98.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.11 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|