C13H8ClN3 — CID 143469743
6-chloro-1-methyl-5H-pyrido[4,3-b]indole-4-carbonitrile (PubChem CID 143469743) has the molecular formula C13H8ClN3 and a molecular weight of 241.68 g/mol. Its IUPAC name is 6-chloro-1-methyl-5H-pyrido[4,3-b]indole-4-carbonitrile.
| Compound Name | 6-chloro-1-methyl-5H-pyrido[4,3-b]indole-4-carbonitrile |
|---|---|
| PubChem CID | 143469743 |
| Molecular Formula | C13H8ClN3 |
| Molecular Weight | 241.68 g/mol |
| Exact Mass | 241.04 |
| IUPAC Name | 6-chloro-1-methyl-5H-pyrido[4,3-b]indole-4-carbonitrile |
| SMILES | Cc1ncc(C#N)c2[nH]c3c(Cl)cccc3c12 |
| InChI | InChI=1S/C13H8ClN3/c1-7-11-9-3-2-4-10(14)13(9)17-12(11)8(5-15)6-16-7/h2-4,6,17H,1H3 |
| InChIKey | OTVVLPOIIOACOG-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 52.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.68 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |