C12H9ClN4O — CID 23582061
1-amino-6-chloro-5H-pyrido[4,3-b]indole-4-carboxamide (PubChem CID 23582061) has the molecular formula C12H9ClN4O and a molecular weight of 260.68 g/mol. Its IUPAC name is 1-amino-6-chloro-5H-pyrido[4,3-b]indole-4-carboxamide.
| Compound Name | 1-amino-6-chloro-5H-pyrido[4,3-b]indole-4-carboxamide |
|---|---|
| PubChem CID | 23582061 |
| Molecular Formula | C12H9ClN4O |
| Molecular Weight | 260.68 g/mol |
| Exact Mass | 260.05 |
| IUPAC Name | 1-amino-6-chloro-5H-pyrido[4,3-b]indole-4-carboxamide |
| SMILES | NC(=O)c1cnc(N)c2c1[nH]c1c(Cl)cccc12 |
| InChI | InChI=1S/C12H9ClN4O/c13-7-3-1-2-5-8-10(17-9(5)7)6(12(15)18)4-16-11(8)14/h1-4,17H,(H2,14,16)(H2,15,18) |
| InChIKey | WFAKTIXTQACENU-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 97.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.68 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |