C31H23F10N3O3 — CID 143471609
4-fluoro-N-[(R)-[4-fluoro-3-(hydrazinecarbonyl)phenyl]-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]methyl]-3-(trifluoromethyl)benzamide;toluene (PubChem CID 143471609) has the molecular formula C31H23F10N3O3 and a molecular weight of 675.52 g/mol. Its IUPAC name is 4-fluoro-N-[(R)-[4-fluoro-3-(hydrazinecarbonyl)phenyl]-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]methyl]-3-(trifluoromethyl)benzamide;toluene.
| Compound Name | 4-fluoro-N-[(R)-[4-fluoro-3-(hydrazinecarbonyl)phenyl]-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]methyl]-3-(trifluoromethyl)benzamide;toluene |
|---|---|
| PubChem CID | 143471609 |
| Molecular Formula | C31H23F10N3O3 |
| Molecular Weight | 675.52 g/mol |
| Exact Mass | 675.16 |
| IUPAC Name | 4-fluoro-N-[(R)-[4-fluoro-3-(hydrazinecarbonyl)phenyl]-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]methyl]-3-(trifluoromethyl)benzamide;toluene |
| SMILES | Cc1ccccc1.NNC(=O)c1cc([C@@H](NC(=O)c2ccc(F)c(C(F)(F)F)c2)c2cc(F)cc(OC(F)(F)C(F)F)c2)ccc1F |
| InChI | InChI=1S/C24H15F10N3O3.C7H8/c25-13-5-12(6-14(9-13)40-24(33,34)22(28)29)19(10-1-3-17(26)15(7-10)21(39)37-35)36-20(38)11-2-4-18(27)16(8-11)23(30,31)32;1-7-5-3-2-4-6-7/h1-9,19,22H,35H2,(H,36,38)(H,37,39);2-6H,1H3/t19-;/m1./s1 |
| InChIKey | HHQQAKBAGDHVON-FSRHSHDFSA-N |
| XLogP | 7.48 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.52 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|