C19H15F9N2O2 — CID 89360076
3-amino-4,4,4-trifluoro-N-[(R)-(4-fluorophenyl)-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]methyl]butanamide (PubChem CID 89360076) has the molecular formula C19H15F9N2O2 and a molecular weight of 474.32 g/mol. Its IUPAC name is 3-amino-4,4,4-trifluoro-N-[(R)-(4-fluorophenyl)-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]methyl]butanamide.
| Compound Name | 3-amino-4,4,4-trifluoro-N-[(R)-(4-fluorophenyl)-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]methyl]butanamide |
|---|---|
| PubChem CID | 89360076 |
| Molecular Formula | C19H15F9N2O2 |
| Molecular Weight | 474.32 g/mol |
| Exact Mass | 474.10 |
| IUPAC Name | 3-amino-4,4,4-trifluoro-N-[(R)-(4-fluorophenyl)-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]methyl]butanamide |
| SMILES | NC(CC(=O)N[C@H](c1ccc(F)cc1)c1cc(F)cc(OC(F)(F)C(F)F)c1)C(F)(F)F |
| InChI | InChI=1S/C19H15F9N2O2/c20-11-3-1-9(2-4-11)16(30-15(31)8-14(29)18(24,25)26)10-5-12(21)7-13(6-10)32-19(27,28)17(22)23/h1-7,14,16-17H,8,29H2,(H,30,31)/t14?,16-/m1/s1 |
| InChIKey | KRIQWTWNHVJYBB-BZSJEYESSA-N |
| XLogP | 4.69 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.32 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|