C16H12F6O3 — CID 59458706
(4-fluoro-3-methoxyphenyl)-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]methanol (PubChem CID 59458706) has the molecular formula C16H12F6O3 and a molecular weight of 366.26 g/mol. Its IUPAC name is (4-fluoro-3-methoxyphenyl)-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]methanol.
| Compound Name | (4-fluoro-3-methoxyphenyl)-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]methanol |
|---|---|
| PubChem CID | 59458706 |
| Molecular Formula | C16H12F6O3 |
| Molecular Weight | 366.26 g/mol |
| Exact Mass | 366.07 |
| IUPAC Name | (4-fluoro-3-methoxyphenyl)-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]methanol |
| SMILES | COc1cc(C(O)c2cc(F)cc(OC(F)(F)C(F)F)c2)ccc1F |
| InChI | InChI=1S/C16H12F6O3/c1-24-13-6-8(2-3-12(13)18)14(23)9-4-10(17)7-11(5-9)25-16(21,22)15(19)20/h2-7,14-15,23H,1H3 |
| InChIKey | LDCYIUWEZULSMG-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.26 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|