C23H18F6O2 — CID 143474978
1-fluoro-3-[(1R)-1-(4-fluoro-3-methoxyphenyl)-2-phenylethyl]-5-(1,1,2,2-tetrafluoroethoxy)benzene (PubChem CID 143474978) has the molecular formula C23H18F6O2 and a molecular weight of 440.38 g/mol. Its IUPAC name is 1-fluoro-3-[(1R)-1-(4-fluoro-3-methoxyphenyl)-2-phenylethyl]-5-(1,1,2,2-tetrafluoroethoxy)benzene.
| Compound Name | 1-fluoro-3-[(1R)-1-(4-fluoro-3-methoxyphenyl)-2-phenylethyl]-5-(1,1,2,2-tetrafluoroethoxy)benzene |
|---|---|
| PubChem CID | 143474978 |
| Molecular Formula | C23H18F6O2 |
| Molecular Weight | 440.38 g/mol |
| Exact Mass | 440.12 |
| IUPAC Name | 1-fluoro-3-[(1R)-1-(4-fluoro-3-methoxyphenyl)-2-phenylethyl]-5-(1,1,2,2-tetrafluoroethoxy)benzene |
| SMILES | COc1cc([C@@H](Cc2ccccc2)c2cc(F)cc(OC(F)(F)C(F)F)c2)ccc1F |
| InChI | InChI=1S/C23H18F6O2/c1-30-21-12-15(7-8-20(21)25)19(9-14-5-3-2-4-6-14)16-10-17(24)13-18(11-16)31-23(28,29)22(26)27/h2-8,10-13,19,22H,9H2,1H3/t19-/m1/s1 |
| InChIKey | YOMZULBYCCEFAN-LJQANCHMSA-N |
| XLogP | 6.58 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.38 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|