C12H10F8N2O2 — CID 143472844
3-amino-4,4,4-trifluoro-N-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]butanamide (PubChem CID 143472844) has the molecular formula C12H10F8N2O2 and a molecular weight of 366.21 g/mol. Its IUPAC name is 3-amino-4,4,4-trifluoro-N-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]butanamide.
| Compound Name | 3-amino-4,4,4-trifluoro-N-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]butanamide |
|---|---|
| PubChem CID | 143472844 |
| Molecular Formula | C12H10F8N2O2 |
| Molecular Weight | 366.21 g/mol |
| Exact Mass | 366.06 |
| IUPAC Name | 3-amino-4,4,4-trifluoro-N-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]butanamide |
| SMILES | NC(CC(=O)Nc1cc(F)cc(OC(F)(F)C(F)F)c1)C(F)(F)F |
| InChI | InChI=1S/C12H10F8N2O2/c13-5-1-6(22-9(23)4-8(21)11(16,17)18)3-7(2-5)24-12(19,20)10(14)15/h1-3,8,10H,4,21H2,(H,22,23) |
| InChIKey | KMGJQDVWDKPDSU-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.21 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|