C24H16BrF11O3 — CID 159936262
1-bromo-3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)benzene;(4-fluorophenyl)-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]methanone;methane (PubChem CID 159936262) has the molecular formula C24H16BrF11O3 and a molecular weight of 641.27 g/mol. Its IUPAC name is 1-bromo-3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)benzene;(4-fluorophenyl)-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]methanone;methane.
| Compound Name | 1-bromo-3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)benzene;(4-fluorophenyl)-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]methanone;methane |
|---|---|
| PubChem CID | 159936262 |
| Molecular Formula | C24H16BrF11O3 |
| Molecular Weight | 641.27 g/mol |
| Exact Mass | 640.01 |
| IUPAC Name | 1-bromo-3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)benzene;(4-fluorophenyl)-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]methanone;methane |
| SMILES | C.Fc1cc(Br)cc(OC(F)(F)C(F)F)c1.O=C(c1ccc(F)cc1)c1cc(F)cc(OC(F)(F)C(F)F)c1 |
| InChI | InChI=1S/C15H8F6O2.C8H4BrF5O.CH4/c16-10-3-1-8(2-4-10)13(22)9-5-11(17)7-12(6-9)23-15(20,21)14(18)19;9-4-1-5(10)3-6(2-4)15-8(13,14)7(11)12;/h1-7,14H;1-3,7H;1H4 |
| InChIKey | OAHDXAMFKIOMHY-UHFFFAOYSA-N |
| XLogP | 8.89 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.27 |
| LogP ≤ 5 | 8.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|