C19H13F9N2O2 — CID 143471951
N-[[3-[2-(difluoroamino)-2,2-difluoroacetyl]-5-fluorophenyl]-(4-fluorophenyl)methyl]-4,4,4-trifluorobutanamide (PubChem CID 143471951) has the molecular formula C19H13F9N2O2 and a molecular weight of 472.31 g/mol. Its IUPAC name is N-[[3-[2-(difluoroamino)-2,2-difluoroacetyl]-5-fluorophenyl]-(4-fluorophenyl)methyl]-4,4,4-trifluorobutanamide.
| Compound Name | N-[[3-[2-(difluoroamino)-2,2-difluoroacetyl]-5-fluorophenyl]-(4-fluorophenyl)methyl]-4,4,4-trifluorobutanamide |
|---|---|
| PubChem CID | 143471951 |
| Molecular Formula | C19H13F9N2O2 |
| Molecular Weight | 472.31 g/mol |
| Exact Mass | 472.08 |
| IUPAC Name | N-[[3-[2-(difluoroamino)-2,2-difluoroacetyl]-5-fluorophenyl]-(4-fluorophenyl)methyl]-4,4,4-trifluorobutanamide |
| SMILES | O=C(CCC(F)(F)F)NC(c1ccc(F)cc1)c1cc(F)cc(C(=O)C(F)(F)N(F)F)c1 |
| InChI | InChI=1S/C19H13F9N2O2/c20-13-3-1-10(2-4-13)16(29-15(31)5-6-18(22,23)24)11-7-12(9-14(21)8-11)17(32)19(25,26)30(27)28/h1-4,7-9,16H,5-6H2,(H,29,31) |
| InChIKey | RKUUKHWVFWDZMN-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.31 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|