C18H17F6NO — CID 143472632
(R)-(4-fluoro-3-propan-2-yloxyphenyl)-[3-fluoro-5-(1,1,2,2-tetrafluoroethyl)phenyl]methanamine (PubChem CID 143472632) has the molecular formula C18H17F6NO and a molecular weight of 377.33 g/mol. Its IUPAC name is (R)-(4-fluoro-3-propan-2-yloxyphenyl)-[3-fluoro-5-(1,1,2,2-tetrafluoroethyl)phenyl]methanamine.
| Compound Name | (R)-(4-fluoro-3-propan-2-yloxyphenyl)-[3-fluoro-5-(1,1,2,2-tetrafluoroethyl)phenyl]methanamine |
|---|---|
| PubChem CID | 143472632 |
| Molecular Formula | C18H17F6NO |
| Molecular Weight | 377.33 g/mol |
| Exact Mass | 377.12 |
| IUPAC Name | (R)-(4-fluoro-3-propan-2-yloxyphenyl)-[3-fluoro-5-(1,1,2,2-tetrafluoroethyl)phenyl]methanamine |
| SMILES | CC(C)Oc1cc([C@@H](N)c2cc(F)cc(C(F)(F)C(F)F)c2)ccc1F |
| InChI | InChI=1S/C18H17F6NO/c1-9(2)26-15-7-10(3-4-14(15)20)16(25)11-5-12(8-13(19)6-11)18(23,24)17(21)22/h3-9,16-17H,25H2,1-2H3/t16-/m1/s1 |
| InChIKey | IFYUUFMZJPJXGT-MRXNPFEDSA-N |
| XLogP | 5.16 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.33 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|