C19H13F9 — CID 143472724
1-fluoro-3-[(1R)-1-[4-fluoro-3-(trifluoromethyl)phenyl]but-3-enyl]-5-(1,1,2,2-tetrafluoroethyl)benzene (PubChem CID 143472724) has the molecular formula C19H13F9 and a molecular weight of 412.30 g/mol. Its IUPAC name is 1-fluoro-3-[(1R)-1-[4-fluoro-3-(trifluoromethyl)phenyl]but-3-enyl]-5-(1,1,2,2-tetrafluoroethyl)benzene.
| Compound Name | 1-fluoro-3-[(1R)-1-[4-fluoro-3-(trifluoromethyl)phenyl]but-3-enyl]-5-(1,1,2,2-tetrafluoroethyl)benzene |
|---|---|
| PubChem CID | 143472724 |
| Molecular Formula | C19H13F9 |
| Molecular Weight | 412.30 g/mol |
| Exact Mass | 412.09 |
| IUPAC Name | 1-fluoro-3-[(1R)-1-[4-fluoro-3-(trifluoromethyl)phenyl]but-3-enyl]-5-(1,1,2,2-tetrafluoroethyl)benzene |
| SMILES | C=CC[C@@H](c1cc(F)cc(C(F)(F)C(F)F)c1)c1ccc(F)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H13F9/c1-2-3-14(10-4-5-16(21)15(8-10)19(26,27)28)11-6-12(9-13(20)7-11)18(24,25)17(22)23/h2,4-9,14,17H,1,3H2/t14-/m1/s1 |
| InChIKey | LCIRTWYBHFNDMK-CQSZACIVSA-N |
| XLogP | 7.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.30 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|