C22H36O3 — CID 143473393
(2S,4R)-2-ethyl-4-[[4-(2-methylhexyl)phenoxy]methyl]hexanoic acid (PubChem CID 143473393) has the molecular formula C22H36O3 and a molecular weight of 348.53 g/mol. Its IUPAC name is (2S,4R)-2-ethyl-4-[[4-(2-methylhexyl)phenoxy]methyl]hexanoic acid.
| Compound Name | (2S,4R)-2-ethyl-4-[[4-(2-methylhexyl)phenoxy]methyl]hexanoic acid |
|---|---|
| PubChem CID | 143473393 |
| Molecular Formula | C22H36O3 |
| Molecular Weight | 348.53 g/mol |
| Exact Mass | 348.27 |
| IUPAC Name | (2S,4R)-2-ethyl-4-[[4-(2-methylhexyl)phenoxy]methyl]hexanoic acid |
| SMILES | CCCCC(C)Cc1ccc(OC[C@H](CC)CC(CC)C(=O)O)cc1 |
| InChI | InChI=1S/C22H36O3/c1-5-8-9-17(4)14-19-10-12-21(13-11-19)25-16-18(6-2)15-20(7-3)22(23)24/h10-13,17-18,20H,5-9,14-16H2,1-4H3,(H,23,24)/t17?,18-,20?/m1/s1 |
| InChIKey | BPHXSTSHNJMLRQ-QPIRBTGLSA-N |
| XLogP | 5.96 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.53 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |