C23H34ClNO — CID 19885116
3-[4-(2-ethylhexoxy)phenyl]-2-phenylpropan-1-amine;hydrochloride (PubChem CID 19885116) has the molecular formula C23H34ClNO and a molecular weight of 375.98 g/mol. Its IUPAC name is 3-[4-(2-ethylhexoxy)phenyl]-2-phenylpropan-1-amine;hydrochloride.
| Compound Name | 3-[4-(2-ethylhexoxy)phenyl]-2-phenylpropan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 19885116 |
| Molecular Formula | C23H34ClNO |
| Molecular Weight | 375.98 g/mol |
| Exact Mass | 375.23 |
| IUPAC Name | 3-[4-(2-ethylhexoxy)phenyl]-2-phenylpropan-1-amine;hydrochloride |
| SMILES | CCCCC(CC)COc1ccc(CC(CN)c2ccccc2)cc1.Cl |
| InChI | InChI=1S/C23H33NO.ClH/c1-3-5-9-19(4-2)18-25-23-14-12-20(13-15-23)16-22(17-24)21-10-7-6-8-11-21;/h6-8,10-15,19,22H,3-5,9,16-18,24H2,1-2H3;1H |
| InChIKey | JIMUPAZKSYSNMG-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.98 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |