C33H28ClF7N2O2 — CID 143473827
(2S)-N-[(1S)-2-(3-chlorophenyl)-1-[(6E,8Z)-4,5-dihydro-3H-azonin-9-yl]-1-[3-fluoro-5-(trifluoromethyl)phenyl]ethyl]-3,3,3-trifluoro-2-methoxy-2-phenylpropanamide (PubChem CID 143473827) has the molecular formula C33H28ClF7N2O2 and a molecular weight of 653.04 g/mol. Its IUPAC name is (2S)-N-[(1S)-2-(3-chlorophenyl)-1-[(6E,8Z)-4,5-dihydro-3H-azonin-9-yl]-1-[3-fluoro-5-(trifluoromethyl)phenyl]ethyl]-3,3,3-trifluoro-2-methoxy-2-phenylpropanamide.
| Compound Name | (2S)-N-[(1S)-2-(3-chlorophenyl)-1-[(6E,8Z)-4,5-dihydro-3H-azonin-9-yl]-1-[3-fluoro-5-(trifluoromethyl)phenyl]ethyl]-3,3,3-trifluoro-2-methoxy-2-phenylpropanamide |
|---|---|
| PubChem CID | 143473827 |
| Molecular Formula | C33H28ClF7N2O2 |
| Molecular Weight | 653.04 g/mol |
| Exact Mass | 652.17 |
| IUPAC Name | (2S)-N-[(1S)-2-(3-chlorophenyl)-1-[(6E,8Z)-4,5-dihydro-3H-azonin-9-yl]-1-[3-fluoro-5-(trifluoromethyl)phenyl]ethyl]-3,3,3-trifluoro-2-methoxy-2-phenylpropanamide |
| SMILES | CO[C@](C(=O)N[C@](Cc1cccc(Cl)c1)(C1=C/C=C/CCC\C=N\1)c1cc(F)cc(C(F)(F)F)c1)(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C33H28ClF7N2O2/c1-45-31(33(39,40)41,23-12-6-5-7-13-23)29(44)43-30(21-22-11-10-14-26(34)17-22,28-15-8-3-2-4-9-16-42-28)24-18-25(32(36,37)38)20-27(35)19-24/h3,5-8,10-20H,2,4,9,21H2,1H3,(H,43,44)/b8-3+,28-15-,42-16+/t30-,31-/m0/s1 |
| InChIKey | SOUDFGVLTZKEAB-UCMTWHDCSA-N |
| XLogP | 8.85 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.04 |
| LogP ≤ 5 | 8.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |