C32H25F9N2O — CID 143473619
N-[(1S)-1-[(2E,7Z)-5,6-dihydro-4H-azonin-9-yl]-1-[3-fluoro-5-(trifluoromethyl)phenyl]-2-phenylethyl]-3-(2,3,4,5,6-pentafluorophenyl)propanamide (PubChem CID 143473619) has the molecular formula C32H25F9N2O and a molecular weight of 624.55 g/mol. Its IUPAC name is N-[(1S)-1-[(2E,7Z)-5,6-dihydro-4H-azonin-9-yl]-1-[3-fluoro-5-(trifluoromethyl)phenyl]-2-phenylethyl]-3-(2,3,4,5,6-pentafluorophenyl)propanamide.
| Compound Name | N-[(1S)-1-[(2E,7Z)-5,6-dihydro-4H-azonin-9-yl]-1-[3-fluoro-5-(trifluoromethyl)phenyl]-2-phenylethyl]-3-(2,3,4,5,6-pentafluorophenyl)propanamide |
|---|---|
| PubChem CID | 143473619 |
| Molecular Formula | C32H25F9N2O |
| Molecular Weight | 624.55 g/mol |
| Exact Mass | 624.18 |
| IUPAC Name | N-[(1S)-1-[(2E,7Z)-5,6-dihydro-4H-azonin-9-yl]-1-[3-fluoro-5-(trifluoromethyl)phenyl]-2-phenylethyl]-3-(2,3,4,5,6-pentafluorophenyl)propanamide |
| SMILES | O=C(CCc1c(F)c(F)c(F)c(F)c1F)N[C@](Cc1ccccc1)(C1=N/C=C/CCC\C=C\1)c1cc(F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C32H25F9N2O/c33-22-16-20(15-21(17-22)32(39,40)41)31(18-19-9-5-4-6-10-19,24-11-7-2-1-3-8-14-42-24)43-25(44)13-12-23-26(34)28(36)30(38)29(37)27(23)35/h4-11,14-17H,1-3,12-13,18H2,(H,43,44)/b11-7+,14-8+,42-24+/t31-/m0/s1 |
| InChIKey | MPVRTFUGCPUKNQ-PMTTUYIRSA-N |
| XLogP | 8.42 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.55 |
| LogP ≤ 5 | 8.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|