C12H24N2O4 — CID 143475336
tert-butyl N-(5-amino-2-hydroxy-7-oxoheptyl)carbamate (PubChem CID 143475336) has the molecular formula C12H24N2O4 and a molecular weight of 260.33 g/mol. Its IUPAC name is tert-butyl N-(5-amino-2-hydroxy-7-oxoheptyl)carbamate.
| Compound Name | tert-butyl N-(5-amino-2-hydroxy-7-oxoheptyl)carbamate |
|---|---|
| PubChem CID | 143475336 |
| Molecular Formula | C12H24N2O4 |
| Molecular Weight | 260.33 g/mol |
| Exact Mass | 260.17 |
| IUPAC Name | tert-butyl N-(5-amino-2-hydroxy-7-oxoheptyl)carbamate |
| SMILES | CC(C)(C)OC(=O)NCC(O)CCC(N)CC=O |
| InChI | InChI=1S/C12H24N2O4/c1-12(2,3)18-11(17)14-8-10(16)5-4-9(13)6-7-15/h7,9-10,16H,4-6,8,13H2,1-3H3,(H,14,17) |
| InChIKey | APSNXCSGFKUOFR-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.33 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|