C5H5Cl2N3O — CID 143475366
3,5-dichloro-4-hydrazinyl-1H-pyridin-2-one (PubChem CID 143475366) has the molecular formula C5H5Cl2N3O and a molecular weight of 194.02 g/mol. Its IUPAC name is 3,5-dichloro-4-hydrazinyl-1H-pyridin-2-one.
| Compound Name | 3,5-dichloro-4-hydrazinyl-1H-pyridin-2-one |
|---|---|
| PubChem CID | 143475366 |
| Molecular Formula | C5H5Cl2N3O |
| Molecular Weight | 194.02 g/mol |
| Exact Mass | 192.98 |
| IUPAC Name | 3,5-dichloro-4-hydrazinyl-1H-pyridin-2-one |
| SMILES | NNc1c(Cl)c[nH]c(=O)c1Cl |
| InChI | InChI=1S/C5H5Cl2N3O/c6-2-1-9-5(11)3(7)4(2)10-8/h1H,8H2,(H2,9,10,11) |
| InChIKey | BCBVCCLMXPPEMT-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 70.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.02 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|