C38H54Cl2N6O2S2 — CID 143475619
5-[4,5-bis(4-chlorophenyl)-5-methyl-3-nitroso-4H-imidazol-2-yl]-2-tert-butyl-4-ethoxybenzenethiol;N-methylmethanamine;1-(3-methylsulfanylpropyl)piperazine (PubChem CID 143475619) has the molecular formula C38H54Cl2N6O2S2 and a molecular weight of 761.93 g/mol. Its IUPAC name is 5-[4,5-bis(4-chlorophenyl)-5-methyl-3-nitroso-4H-imidazol-2-yl]-2-tert-butyl-4-ethoxybenzenethiol;N-methylmethanamine;1-(3-methylsulfanylpropyl)piperazine.
| Compound Name | 5-[4,5-bis(4-chlorophenyl)-5-methyl-3-nitroso-4H-imidazol-2-yl]-2-tert-butyl-4-ethoxybenzenethiol;N-methylmethanamine;1-(3-methylsulfanylpropyl)piperazine |
|---|---|
| PubChem CID | 143475619 |
| Molecular Formula | C38H54Cl2N6O2S2 |
| Molecular Weight | 761.93 g/mol |
| Exact Mass | 760.31 |
| IUPAC Name | 5-[4,5-bis(4-chlorophenyl)-5-methyl-3-nitroso-4H-imidazol-2-yl]-2-tert-butyl-4-ethoxybenzenethiol;N-methylmethanamine;1-(3-methylsulfanylpropyl)piperazine |
| SMILES | CCOc1cc(C(C)(C)C)c(S)cc1C1=NC(C)(c2ccc(Cl)cc2)C(c2ccc(Cl)cc2)N1N=O.CNC.CSCCCN1CCNCC1 |
| InChI | InChI=1S/C28H29Cl2N3O2S.C8H18N2S.C2H7N/c1-6-35-23-16-22(27(2,3)4)24(36)15-21(23)26-31-28(5,18-9-13-20(30)14-10-18)25(33(26)32-34)17-7-11-19(29)12-8-17;1-11-8-2-5-10-6-3-9-4-7-10;1-3-2/h7-16,25,36H,6H2,1-5H3;9H,2-8H2,1H3;3H,1-2H3 |
| InChIKey | IHKRFGGFSZAUJD-UHFFFAOYSA-N |
| XLogP | 8.86 |
| TPSA | 81.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 761.93 |
| LogP ≤ 5 | 8.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|