C32H38ClN5O2 — CID 143787324
[(5S)-2-(6-tert-butyl-4-ethoxy-3-pyridinyl)-5-(4-chlorophenyl)-4,5-dimethyl-4H-imidazol-3-yl]-(1,2,3,4-tetrahydro-1,5-benzodiazepin-5-yl)methanone (PubChem CID 143787324) has the molecular formula C32H38ClN5O2 and a molecular weight of 560.14 g/mol. Its IUPAC name is [(5S)-2-(6-tert-butyl-4-ethoxy-3-pyridinyl)-5-(4-chlorophenyl)-4,5-dimethyl-4H-imidazol-3-yl]-(1,2,3,4-tetrahydro-1,5-benzodiazepin-5-yl)methanone.
| Compound Name | [(5S)-2-(6-tert-butyl-4-ethoxy-3-pyridinyl)-5-(4-chlorophenyl)-4,5-dimethyl-4H-imidazol-3-yl]-(1,2,3,4-tetrahydro-1,5-benzodiazepin-5-yl)methanone |
|---|---|
| PubChem CID | 143787324 |
| Molecular Formula | C32H38ClN5O2 |
| Molecular Weight | 560.14 g/mol |
| Exact Mass | 559.27 |
| IUPAC Name | [(5S)-2-(6-tert-butyl-4-ethoxy-3-pyridinyl)-5-(4-chlorophenyl)-4,5-dimethyl-4H-imidazol-3-yl]-(1,2,3,4-tetrahydro-1,5-benzodiazepin-5-yl)methanone |
| SMILES | CCOc1cc(C(C)(C)C)ncc1C1=N[C@@](C)(c2ccc(Cl)cc2)C(C)N1C(=O)N1CCCNc2ccccc21 |
| InChI | InChI=1S/C32H38ClN5O2/c1-7-40-27-19-28(31(3,4)5)35-20-24(27)29-36-32(6,22-13-15-23(33)16-14-22)21(2)38(29)30(39)37-18-10-17-34-25-11-8-9-12-26(25)37/h8-9,11-16,19-21,34H,7,10,17-18H2,1-6H3/t21?,32-/m1/s1 |
| InChIKey | BPJSNQYQGXQLHR-XSPBBNBHSA-N |
| XLogP | 7.24 |
| TPSA | 70.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.14 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |