C28H29Cl2N3O2S — CID 143475620
5-[4,5-bis(4-chlorophenyl)-5-methyl-3-nitroso-4H-imidazol-2-yl]-2-tert-butyl-4-ethoxybenzenethiol (PubChem CID 143475620) has the molecular formula C28H29Cl2N3O2S and a molecular weight of 542.53 g/mol. Its IUPAC name is 5-[4,5-bis(4-chlorophenyl)-5-methyl-3-nitroso-4H-imidazol-2-yl]-2-tert-butyl-4-ethoxybenzenethiol.
| Compound Name | 5-[4,5-bis(4-chlorophenyl)-5-methyl-3-nitroso-4H-imidazol-2-yl]-2-tert-butyl-4-ethoxybenzenethiol |
|---|---|
| PubChem CID | 143475620 |
| Molecular Formula | C28H29Cl2N3O2S |
| Molecular Weight | 542.53 g/mol |
| Exact Mass | 541.14 |
| IUPAC Name | 5-[4,5-bis(4-chlorophenyl)-5-methyl-3-nitroso-4H-imidazol-2-yl]-2-tert-butyl-4-ethoxybenzenethiol |
| SMILES | CCOc1cc(C(C)(C)C)c(S)cc1C1=NC(C)(c2ccc(Cl)cc2)C(c2ccc(Cl)cc2)N1N=O |
| InChI | InChI=1S/C28H29Cl2N3O2S/c1-6-35-23-16-22(27(2,3)4)24(36)15-21(23)26-31-28(5,18-9-13-20(30)14-10-18)25(33(26)32-34)17-7-11-19(29)12-8-17/h7-16,25,36H,6H2,1-5H3 |
| InChIKey | HEUBOQSANRLSBJ-UHFFFAOYSA-N |
| XLogP | 8.38 |
| TPSA | 54.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.53 |
| LogP ≤ 5 | 8.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|