About 8-[(4-fluorocyclohexa-1,5-dien-1-yl)methyl]-1,4-dioxaspiro[4.5]decane
8-[(4-fluorocyclohexa-1,5-dien-1-yl)methyl]-1,4-dioxaspiro[4.5]decane (PubChem CID 143476806) has the molecular formula C15H21FO2
and a molecular weight of 252.33 g/mol. Its IUPAC name is 8-[(4-fluorocyclohexa-1,5-dien-1-yl)methyl]-1,4-dioxaspiro[4.5]decane.
Molecular Properties
| Compound Name | 8-[(4-fluorocyclohexa-1,5-dien-1-yl)methyl]-1,4-dioxaspiro[4.5]decane |
| PubChem CID | 143476806 |
| Molecular Formula | C15H21FO2 |
| Molecular Weight | 252.33 g/mol |
| Exact Mass | 252.15 |
| IUPAC Name | 8-[(4-fluorocyclohexa-1,5-dien-1-yl)methyl]-1,4-dioxaspiro[4.5]decane |
| SMILES | FC1C=CC(CC2CCC3(CC2)OCCO3)=CC1 |
| InChI | InChI=1S/C15H21FO2/c16-14-3-1-12(2-4-14)11-13-5-7-15(8-6-13)17-9-10-18-15/h1-3,13-14H,4-11H2 |
| InChIKey | IUFLKAIYQZJYMD-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.33 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 8-[(4-fluorocyclohexa-1,5-dien-1-yl)methyl]-1,4-dioxaspiro[4.5]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-[(4-fluorocyclohexa-1,5-dien-1-yl)methyl]-1,4-dioxaspiro[4.5]decane?
The IUPAC name of 8-[(4-fluorocyclohexa-1,5-dien-1-yl)methyl]-1,4-dioxaspiro[4.5]decane (CID 143476806) is 8-[(4-fluorocyclohexa-1,5-dien-1-yl)methyl]-1,4-dioxaspiro[4.5]decane.
What is the SMILES notation for 8-[(4-fluorocyclohexa-1,5-dien-1-yl)methyl]-1,4-dioxaspiro[4.5]decane?
The canonical SMILES for 8-[(4-fluorocyclohexa-1,5-dien-1-yl)methyl]-1,4-dioxaspiro[4.5]decane is FC1C=CC(CC2CCC3(CC2)OCCO3)=CC1.
What is the InChIKey of 8-[(4-fluorocyclohexa-1,5-dien-1-yl)methyl]-1,4-dioxaspiro[4.5]decane?
The InChIKey is IUFLKAIYQZJYMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21FO2/c16-14-3-1-12(2-4-14)11-13-5-7-15(8-6-13)17-9-10-18-15/h1-3,13-14H,4-11H2.
What are the key properties of 8-[(4-fluorocyclohexa-1,5-dien-1-yl)methyl]-1,4-dioxaspiro[4.5]decane?
8-[(4-fluorocyclohexa-1,5-dien-1-yl)methyl]-1,4-dioxaspiro[4.5]decane has a molecular weight of 252.33 g/mol, XLogP of 3.53, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-[(4-fluorocyclohexa-1,5-dien-1-yl)methyl]-1,4-dioxaspiro[4.5]decane is sourced from PubChem (CID 143476806), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).