About N-cyclohexylbicyclo[4.1.0]hept-3-en-2-imine;N-methylpropan-2-amine
N-cyclohexylbicyclo[4.1.0]hept-3-en-2-imine;N-methylpropan-2-amine (PubChem CID 143478087) has the molecular formula C17H30N2
and a molecular weight of 262.44 g/mol. Its IUPAC name is N-cyclohexylbicyclo[4.1.0]hept-3-en-2-imine;N-methylpropan-2-amine.
Molecular Properties
| Compound Name | N-cyclohexylbicyclo[4.1.0]hept-3-en-2-imine;N-methylpropan-2-amine |
| PubChem CID | 143478087 |
| Molecular Formula | C17H30N2 |
| Molecular Weight | 262.44 g/mol |
| Exact Mass | 262.24 |
| IUPAC Name | N-cyclohexylbicyclo[4.1.0]hept-3-en-2-imine;N-methylpropan-2-amine |
| SMILES | C1=C/C(=N\C2CCCCC2)C2CC2C1.CNC(C)C |
| InChI | InChI=1S/C13H19N.C4H11N/c1-2-6-11(7-3-1)14-13-8-4-5-10-9-12(10)13;1-4(2)5-3/h4,8,10-12H,1-3,5-7,9H2;4-5H,1-3H3/b14-13+; |
| InChIKey | CCWHXAHPOBJKRW-IERUDJENSA-N |
| XLogP | 3.97 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.44 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-cyclohexylbicyclo[4.1.0]hept-3-en-2-imine;N-methylpropan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclohexylbicyclo[4.1.0]hept-3-en-2-imine;N-methylpropan-2-amine?
The IUPAC name of N-cyclohexylbicyclo[4.1.0]hept-3-en-2-imine;N-methylpropan-2-amine (CID 143478087) is N-cyclohexylbicyclo[4.1.0]hept-3-en-2-imine;N-methylpropan-2-amine.
What is the SMILES notation for N-cyclohexylbicyclo[4.1.0]hept-3-en-2-imine;N-methylpropan-2-amine?
The canonical SMILES for N-cyclohexylbicyclo[4.1.0]hept-3-en-2-imine;N-methylpropan-2-amine is C1=C/C(=N\C2CCCCC2)C2CC2C1.CNC(C)C.
What is the InChIKey of N-cyclohexylbicyclo[4.1.0]hept-3-en-2-imine;N-methylpropan-2-amine?
The InChIKey is CCWHXAHPOBJKRW-IERUDJENSA-N. The full InChI is InChI=1S/C13H19N.C4H11N/c1-2-6-11(7-3-1)14-13-8-4-5-10-9-12(10)13;1-4(2)5-3/h4,8,10-12H,1-3,5-7,9H2;4-5H,1-3H3/b14-13+;.
What are the key properties of N-cyclohexylbicyclo[4.1.0]hept-3-en-2-imine;N-methylpropan-2-amine?
N-cyclohexylbicyclo[4.1.0]hept-3-en-2-imine;N-methylpropan-2-amine has a molecular weight of 262.44 g/mol, XLogP of 3.97, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclohexylbicyclo[4.1.0]hept-3-en-2-imine;N-methylpropan-2-amine is sourced from PubChem (CID 143478087), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).